C12H16Cl2NO5PS2 — CID 146458873
3-[[3,5-dichloro-6-[ethoxy(ethylsulfanyl)phosphoryl]oxy-2-pyridinyl]sulfanyl]propanoic acid (PubChem CID 146458873) has the molecular formula C12H16Cl2NO5PS2 and a molecular weight of 420.28 g/mol. Its IUPAC name is 3-[[3,5-dichloro-6-[ethoxy(ethylsulfanyl)phosphoryl]oxy-2-pyridinyl]sulfanyl]propanoic acid.
| Compound Name | 3-[[3,5-dichloro-6-[ethoxy(ethylsulfanyl)phosphoryl]oxy-2-pyridinyl]sulfanyl]propanoic acid |
|---|---|
| PubChem CID | 146458873 |
| Molecular Formula | C12H16Cl2NO5PS2 |
| Molecular Weight | 420.28 g/mol |
| Exact Mass | 418.96 |
| IUPAC Name | 3-[[3,5-dichloro-6-[ethoxy(ethylsulfanyl)phosphoryl]oxy-2-pyridinyl]sulfanyl]propanoic acid |
| SMILES | CCOP(=O)(Oc1nc(SCCC(=O)O)c(Cl)cc1Cl)SCC |
| InChI | InChI=1S/C12H16Cl2NO5PS2/c1-3-19-21(18,23-4-2)20-11-8(13)7-9(14)12(15-11)22-6-5-10(16)17/h7H,3-6H2,1-2H3,(H,16,17) |
| InChIKey | DBQZTUJSVCDEOI-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 85.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.28 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|