C10H14Cl2NO3PS2 — CID 163002883
(3,6-dichloro-5-methylsulfanyl-2-pyridinyl)oxy-diethoxy-sulfanylidene-λ5-phosphane (PubChem CID 163002883) has the molecular formula C10H14Cl2NO3PS2 and a molecular weight of 362.24 g/mol. Its IUPAC name is (3,6-dichloro-5-methylsulfanyl-2-pyridinyl)oxy-diethoxy-sulfanylidene-λ5-phosphane.
| Compound Name | (3,6-dichloro-5-methylsulfanyl-2-pyridinyl)oxy-diethoxy-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 163002883 |
| Molecular Formula | C10H14Cl2NO3PS2 |
| Molecular Weight | 362.24 g/mol |
| Exact Mass | 360.95 |
| IUPAC Name | (3,6-dichloro-5-methylsulfanyl-2-pyridinyl)oxy-diethoxy-sulfanylidene-λ5-phosphane |
| SMILES | CCOP(=S)(OCC)Oc1nc(Cl)c(SC)cc1Cl |
| InChI | InChI=1S/C10H14Cl2NO3PS2/c1-4-14-17(18,15-5-2)16-10-7(11)6-8(19-3)9(12)13-10/h6H,4-5H2,1-3H3 |
| InChIKey | HKLOIZXFGFFRNN-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.24 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|