C12H16Cl2NO6PS — CID 102063854
3-[(3,5-dichloro-6-diethoxyphosphoryloxy-2-pyridinyl)sulfanyl]propanoic acid (PubChem CID 102063854) has the molecular formula C12H16Cl2NO6PS and a molecular weight of 404.21 g/mol. Its IUPAC name is 3-[(3,5-dichloro-6-diethoxyphosphoryloxy-2-pyridinyl)sulfanyl]propanoic acid.
| Compound Name | 3-[(3,5-dichloro-6-diethoxyphosphoryloxy-2-pyridinyl)sulfanyl]propanoic acid |
|---|---|
| PubChem CID | 102063854 |
| Molecular Formula | C12H16Cl2NO6PS |
| Molecular Weight | 404.21 g/mol |
| Exact Mass | 402.98 |
| IUPAC Name | 3-[(3,5-dichloro-6-diethoxyphosphoryloxy-2-pyridinyl)sulfanyl]propanoic acid |
| SMILES | CCOP(=O)(OCC)Oc1nc(SCCC(=O)O)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H16Cl2NO6PS/c1-3-19-22(18,20-4-2)21-11-8(13)7-9(14)12(15-11)23-6-5-10(16)17/h7H,3-6H2,1-2H3,(H,16,17) |
| InChIKey | OJLFUOCCXPZMJY-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 94.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.21 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|