C15H22Cl2NO5PS2 — CID 102063853
6-[(3,5-dichloro-6-diethoxyphosphinothioyloxy-2-pyridinyl)sulfanyl]hexanoic acid (PubChem CID 102063853) has the molecular formula C15H22Cl2NO5PS2 and a molecular weight of 462.36 g/mol. Its IUPAC name is 6-[(3,5-dichloro-6-diethoxyphosphinothioyloxy-2-pyridinyl)sulfanyl]hexanoic acid.
| Compound Name | 6-[(3,5-dichloro-6-diethoxyphosphinothioyloxy-2-pyridinyl)sulfanyl]hexanoic acid |
|---|---|
| PubChem CID | 102063853 |
| Molecular Formula | C15H22Cl2NO5PS2 |
| Molecular Weight | 462.36 g/mol |
| Exact Mass | 461.01 |
| IUPAC Name | 6-[(3,5-dichloro-6-diethoxyphosphinothioyloxy-2-pyridinyl)sulfanyl]hexanoic acid |
| SMILES | CCOP(=S)(OCC)Oc1nc(SCCCCCC(=O)O)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H22Cl2NO5PS2/c1-3-21-24(25,22-4-2)23-14-11(16)10-12(17)15(18-14)26-9-7-5-6-8-13(19)20/h10H,3-9H2,1-2H3,(H,19,20) |
| InChIKey | ZPLWRHAFQLMRPF-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.36 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|