C13H8Cl6N3O4PS — CID 166784613
3-[bis[(3,5,6-trichloro-2-pyridinyl)oxy]phosphinothioylamino]propanoic acid (PubChem CID 166784613) has the molecular formula C13H8Cl6N3O4PS and a molecular weight of 545.98 g/mol. Its IUPAC name is 3-[bis[(3,5,6-trichloro-2-pyridinyl)oxy]phosphinothioylamino]propanoic acid.
| Compound Name | 3-[bis[(3,5,6-trichloro-2-pyridinyl)oxy]phosphinothioylamino]propanoic acid |
|---|---|
| PubChem CID | 166784613 |
| Molecular Formula | C13H8Cl6N3O4PS |
| Molecular Weight | 545.98 g/mol |
| Exact Mass | 542.81 |
| IUPAC Name | 3-[bis[(3,5,6-trichloro-2-pyridinyl)oxy]phosphinothioylamino]propanoic acid |
| SMILES | O=C(O)CCNP(=S)(Oc1nc(Cl)c(Cl)cc1Cl)Oc1nc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H8Cl6N3O4PS/c14-5-3-7(16)12(21-10(5)18)25-27(28,20-2-1-9(23)24)26-13-8(17)4-6(15)11(19)22-13/h3-4H,1-2H2,(H,20,28)(H,23,24) |
| InChIKey | JSPVJHDKMNQZFC-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.98 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|