C10H11Cl4O3P — CID 10594114
1,2,4-trichloro-5-[2-chloroethyl(ethoxy)phosphoryl]oxybenzene (PubChem CID 10594114) has the molecular formula C10H11Cl4O3P and a molecular weight of 351.98 g/mol. Its IUPAC name is 1,2,4-trichloro-5-[2-chloroethyl(ethoxy)phosphoryl]oxybenzene.
| Compound Name | 1,2,4-trichloro-5-[2-chloroethyl(ethoxy)phosphoryl]oxybenzene |
|---|---|
| PubChem CID | 10594114 |
| Molecular Formula | C10H11Cl4O3P |
| Molecular Weight | 351.98 g/mol |
| Exact Mass | 349.92 |
| IUPAC Name | 1,2,4-trichloro-5-[2-chloroethyl(ethoxy)phosphoryl]oxybenzene |
| SMILES | CCOP(=O)(CCCl)Oc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C10H11Cl4O3P/c1-2-16-18(15,4-3-11)17-10-6-8(13)7(12)5-9(10)14/h5-6H,2-4H2,1H3 |
| InChIKey | WFFLODCXLIWDDD-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.98 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|