C16H21Cl3O8P2 — CID 57299961
diethoxyphosphoryl-(2,4,6-trichloro-3-diethoxyphosphorylcarbonylphenyl)methanone (PubChem CID 57299961) has the molecular formula C16H21Cl3O8P2 and a molecular weight of 509.64 g/mol. Its IUPAC name is diethoxyphosphoryl-(2,4,6-trichloro-3-diethoxyphosphorylcarbonylphenyl)methanone.
| Compound Name | diethoxyphosphoryl-(2,4,6-trichloro-3-diethoxyphosphorylcarbonylphenyl)methanone |
|---|---|
| PubChem CID | 57299961 |
| Molecular Formula | C16H21Cl3O8P2 |
| Molecular Weight | 509.64 g/mol |
| Exact Mass | 507.98 |
| IUPAC Name | diethoxyphosphoryl-(2,4,6-trichloro-3-diethoxyphosphorylcarbonylphenyl)methanone |
| SMILES | CCOP(=O)(OCC)C(=O)c1c(Cl)cc(Cl)c(C(=O)P(=O)(OCC)OCC)c1Cl |
| InChI | InChI=1S/C16H21Cl3O8P2/c1-5-24-28(22,25-6-2)15(20)12-10(17)9-11(18)13(14(12)19)16(21)29(23,26-7-3)27-8-4/h9H,5-8H2,1-4H3 |
| InChIKey | FEGAIWGYVSOZED-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.64 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|