C10H9Cl4O3PS — CID 24841757
[(E)-2-chloro-1-(2,4,5-trichlorophenyl)ethenoxy]-dimethoxy-sulfanylidene-λ5-phosphane (PubChem CID 24841757) has the molecular formula C10H9Cl4O3PS and a molecular weight of 382.03 g/mol. Its IUPAC name is [(E)-2-chloro-1-(2,4,5-trichlorophenyl)ethenoxy]-dimethoxy-sulfanylidene-λ5-phosphane.
| Compound Name | [(E)-2-chloro-1-(2,4,5-trichlorophenyl)ethenoxy]-dimethoxy-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 24841757 |
| Molecular Formula | C10H9Cl4O3PS |
| Molecular Weight | 382.03 g/mol |
| Exact Mass | 379.88 |
| IUPAC Name | [(E)-2-chloro-1-(2,4,5-trichlorophenyl)ethenoxy]-dimethoxy-sulfanylidene-λ5-phosphane |
| SMILES | COP(=S)(OC)O/C(=C/Cl)c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C10H9Cl4O3PS/c1-15-18(19,16-2)17-10(5-11)6-3-8(13)9(14)4-7(6)12/h3-5H,1-2H3/b10-5+ |
| InChIKey | QPTDIWSEUDEKNK-BJMVGYQFSA-N |
| XLogP | 5.72 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.03 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|