C14H16Cl6O8P2 — CID 91824752
[(E)-2-chloro-1-(2,4,5-trichlorophenyl)ethenyl] dimethyl phosphate;2,2-dichloroethenyl dimethyl phosphate (PubChem CID 91824752) has the molecular formula C14H16Cl6O8P2 and a molecular weight of 586.94 g/mol. Its IUPAC name is [(E)-2-chloro-1-(2,4,5-trichlorophenyl)ethenyl] dimethyl phosphate;2,2-dichloroethenyl dimethyl phosphate.
| Compound Name | [(E)-2-chloro-1-(2,4,5-trichlorophenyl)ethenyl] dimethyl phosphate;2,2-dichloroethenyl dimethyl phosphate |
|---|---|
| PubChem CID | 91824752 |
| Molecular Formula | C14H16Cl6O8P2 |
| Molecular Weight | 586.94 g/mol |
| Exact Mass | 583.85 |
| IUPAC Name | [(E)-2-chloro-1-(2,4,5-trichlorophenyl)ethenyl] dimethyl phosphate;2,2-dichloroethenyl dimethyl phosphate |
| SMILES | COP(=O)(OC)O/C(=C/Cl)c1cc(Cl)c(Cl)cc1Cl.COP(=O)(OC)OC=C(Cl)Cl |
| InChI | InChI=1S/C10H9Cl4O4P.C4H7Cl2O4P/c1-16-19(15,17-2)18-10(5-11)6-3-8(13)9(14)4-7(6)12;1-8-11(7,9-2)10-3-4(5)6/h3-5H,1-2H3;3H,1-2H3/b10-5+; |
| InChIKey | BCJPMPDBQSCNBS-OAZHBLANSA-N |
| XLogP | 8.28 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.94 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|