C12H6Cl3O4P — CID 58014055
2-[[(Z)-2-chloro-1-(2,4-dichlorophenyl)ethenoxy]-ethynoxyphosphoryl]ethenone (PubChem CID 58014055) has the molecular formula C12H6Cl3O4P and a molecular weight of 351.51 g/mol. Its IUPAC name is 2-[[(Z)-2-chloro-1-(2,4-dichlorophenyl)ethenoxy]-ethynoxyphosphoryl]ethenone.
| Compound Name | 2-[[(Z)-2-chloro-1-(2,4-dichlorophenyl)ethenoxy]-ethynoxyphosphoryl]ethenone |
|---|---|
| PubChem CID | 58014055 |
| Molecular Formula | C12H6Cl3O4P |
| Molecular Weight | 351.51 g/mol |
| Exact Mass | 349.91 |
| IUPAC Name | 2-[[(Z)-2-chloro-1-(2,4-dichlorophenyl)ethenoxy]-ethynoxyphosphoryl]ethenone |
| SMILES | C#COP(=O)(C=C=O)O/C(=C\Cl)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H6Cl3O4P/c1-2-18-20(17,6-5-16)19-12(8-13)10-4-3-9(14)7-11(10)15/h1,3-4,6-8H/b12-8- |
| InChIKey | RODIEEHNVYCLRI-WQLSENKSSA-N |
| XLogP | 4.69 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.51 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|