C30H40Cl5O14P3 — CID 87221812
[(Z)-2-chloro-1-(2,4-dichlorophenyl)ethenyl] diethyl phosphate;2,2-dichloroethenyl dimethyl phosphate;1-phenylethyl (E)-3-dimethoxyphosphoryloxybut-2-enoate (PubChem CID 87221812) has the molecular formula C30H40Cl5O14P3 and a molecular weight of 894.82 g/mol. Its IUPAC name is [(Z)-2-chloro-1-(2,4-dichlorophenyl)ethenyl] diethyl phosphate;2,2-dichloroethenyl dimethyl phosphate;1-phenylethyl (E)-3-dimethoxyphosphoryloxybut-2-enoate.
| Compound Name | [(Z)-2-chloro-1-(2,4-dichlorophenyl)ethenyl] diethyl phosphate;2,2-dichloroethenyl dimethyl phosphate;1-phenylethyl (E)-3-dimethoxyphosphoryloxybut-2-enoate |
|---|---|
| PubChem CID | 87221812 |
| Molecular Formula | C30H40Cl5O14P3 |
| Molecular Weight | 894.82 g/mol |
| Exact Mass | 892.01 |
| IUPAC Name | [(Z)-2-chloro-1-(2,4-dichlorophenyl)ethenyl] diethyl phosphate;2,2-dichloroethenyl dimethyl phosphate;1-phenylethyl (E)-3-dimethoxyphosphoryloxybut-2-enoate |
| SMILES | CCOP(=O)(OCC)O/C(=C\Cl)c1ccc(Cl)cc1Cl.COP(=O)(OC)O/C(C)=C/C(=O)OC(C)c1ccccc1.COP(=O)(OC)OC=C(Cl)Cl |
| InChI | InChI=1S/C14H19O6P.C12H14Cl3O4P.C4H7Cl2O4P/c1-11(20-21(16,17-3)18-4)10-14(15)19-12(2)13-8-6-5-7-9-13;1-3-17-20(16,18-4-2)19-12(8-13)10-6-5-9(14)7-11(10)15;1-8-11(7,9-2)10-3-4(5)6/h5-10,12H,1-4H3;5-8H,3-4H2,1-2H3;3H,1-2H3/b11-10+;12-8-; |
| InChIKey | NDXULHBVSIGUEC-QUSMRZDPSA-N |
| XLogP | 12.02 |
| TPSA | 160.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 894.82 |
| LogP ≤ 5 | 12.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|