C8H7Cl4O3P — CID 20542159
1,2,4,5-tetrachloro-3-dimethoxyphosphorylbenzene (PubChem CID 20542159) has the molecular formula C8H7Cl4O3P and a molecular weight of 323.93 g/mol. Its IUPAC name is 1,2,4,5-tetrachloro-3-dimethoxyphosphorylbenzene.
| Compound Name | 1,2,4,5-tetrachloro-3-dimethoxyphosphorylbenzene |
|---|---|
| PubChem CID | 20542159 |
| Molecular Formula | C8H7Cl4O3P |
| Molecular Weight | 323.93 g/mol |
| Exact Mass | 321.89 |
| IUPAC Name | 1,2,4,5-tetrachloro-3-dimethoxyphosphorylbenzene |
| SMILES | COP(=O)(OC)c1c(Cl)c(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C8H7Cl4O3P/c1-14-16(13,15-2)8-6(11)4(9)3-5(10)7(8)12/h3H,1-2H3 |
| InChIKey | WTDVXKKMIUZIMD-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.93 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|