C10H9Cl4O4P — CID 15648813
[(Z)-1-chloro-2-(2,4,5-trichlorophenyl)ethenyl] dimethyl phosphate (PubChem CID 15648813) has the molecular formula C10H9Cl4O4P and a molecular weight of 365.96 g/mol. Its IUPAC name is [(Z)-1-chloro-2-(2,4,5-trichlorophenyl)ethenyl] dimethyl phosphate.
| Compound Name | [(Z)-1-chloro-2-(2,4,5-trichlorophenyl)ethenyl] dimethyl phosphate |
|---|---|
| PubChem CID | 15648813 |
| Molecular Formula | C10H9Cl4O4P |
| Molecular Weight | 365.96 g/mol |
| Exact Mass | 363.90 |
| IUPAC Name | [(Z)-1-chloro-2-(2,4,5-trichlorophenyl)ethenyl] dimethyl phosphate |
| SMILES | COP(=O)(OC)O/C(Cl)=C/c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C10H9Cl4O4P/c1-16-19(15,17-2)18-10(14)4-6-3-8(12)9(13)5-7(6)11/h3-5H,1-2H3/b10-4+ |
| InChIKey | DAQURACMSFYBNM-ONNFQVAWSA-N |
| XLogP | 5.60 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.96 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|