C9H6Cl3O3S- — CID 134087288
(Z)-2-methylsulfonyl-1-(2,4,5-trichlorophenyl)ethenolate (PubChem CID 134087288) has the molecular formula C9H6Cl3O3S- and a molecular weight of 300.57 g/mol. Its IUPAC name is (Z)-2-methylsulfonyl-1-(2,4,5-trichlorophenyl)ethenolate.
| Compound Name | (Z)-2-methylsulfonyl-1-(2,4,5-trichlorophenyl)ethenolate |
|---|---|
| PubChem CID | 134087288 |
| Molecular Formula | C9H6Cl3O3S- |
| Molecular Weight | 300.57 g/mol |
| Exact Mass | 298.91 |
| IUPAC Name | (Z)-2-methylsulfonyl-1-(2,4,5-trichlorophenyl)ethenolate |
| SMILES | CS(=O)(=O)/C=C(\[O-])c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C9H7Cl3O3S/c1-16(14,15)4-9(13)5-2-7(11)8(12)3-6(5)10/h2-4,13H,1H3/p-1/b9-4- |
| InChIKey | QOLUOCYJUWAFTB-WTKPLQERSA-M |
| XLogP | 2.35 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.57 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|