C18H17Cl2N4O3PS — CID 46237851
(Z)-N-[(2,4-dichlorophenoxy)-ethoxyphosphinothioyl]oxy-1-phenyl-2-(1,2,4-triazol-1-yl)ethanimine (PubChem CID 46237851) has the molecular formula C18H17Cl2N4O3PS and a molecular weight of 471.31 g/mol. Its IUPAC name is (Z)-N-[(2,4-dichlorophenoxy)-ethoxyphosphinothioyl]oxy-1-phenyl-2-(1,2,4-triazol-1-yl)ethanimine.
| Compound Name | (Z)-N-[(2,4-dichlorophenoxy)-ethoxyphosphinothioyl]oxy-1-phenyl-2-(1,2,4-triazol-1-yl)ethanimine |
|---|---|
| PubChem CID | 46237851 |
| Molecular Formula | C18H17Cl2N4O3PS |
| Molecular Weight | 471.31 g/mol |
| Exact Mass | 470.01 |
| IUPAC Name | (Z)-N-[(2,4-dichlorophenoxy)-ethoxyphosphinothioyl]oxy-1-phenyl-2-(1,2,4-triazol-1-yl)ethanimine |
| SMILES | CCOP(=S)(O/N=C(\Cn1cncn1)c1ccccc1)Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H17Cl2N4O3PS/c1-2-25-28(29,26-18-9-8-15(19)10-16(18)20)27-23-17(11-24-13-21-12-22-24)14-6-4-3-5-7-14/h3-10,12-13H,2,11H2,1H3/b23-17+ |
| InChIKey | YGXFJUXUJVZVSL-HAVVHWLPSA-N |
| XLogP | 5.35 |
| TPSA | 70.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.31 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|