C19H15ClN4O2 — CID 22815788
(E)-1-[4-(4-chlorophenoxy)phenyl]-N-prop-2-ynoxy-2-(1,2,4-triazol-1-yl)ethanimine (PubChem CID 22815788) has the molecular formula C19H15ClN4O2 and a molecular weight of 366.81 g/mol. Its IUPAC name is (E)-1-[4-(4-chlorophenoxy)phenyl]-N-prop-2-ynoxy-2-(1,2,4-triazol-1-yl)ethanimine.
| Compound Name | (E)-1-[4-(4-chlorophenoxy)phenyl]-N-prop-2-ynoxy-2-(1,2,4-triazol-1-yl)ethanimine |
|---|---|
| PubChem CID | 22815788 |
| Molecular Formula | C19H15ClN4O2 |
| Molecular Weight | 366.81 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | (E)-1-[4-(4-chlorophenoxy)phenyl]-N-prop-2-ynoxy-2-(1,2,4-triazol-1-yl)ethanimine |
| SMILES | C#CCO/N=C(/Cn1cncn1)c1ccc(Oc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C19H15ClN4O2/c1-2-11-25-23-19(12-24-14-21-13-22-24)15-3-7-17(8-4-15)26-18-9-5-16(20)6-10-18/h1,3-10,13-14H,11-12H2/b23-19- |
| InChIKey | YGXDZJQZZNISSD-NMWGTECJSA-N |
| XLogP | 3.78 |
| TPSA | 61.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.81 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|