C20H17ClN6S — CID 177450317
N-[(Z)-[1-(4-chlorophenyl)-2-(1,2,4-triazol-1-yl)ethylidene]amino]-4-(4-methylphenyl)-1,3-thiazol-2-amine (PubChem CID 177450317) has the molecular formula C20H17ClN6S and a molecular weight of 408.92 g/mol. Its IUPAC name is N-[(Z)-[1-(4-chlorophenyl)-2-(1,2,4-triazol-1-yl)ethylidene]amino]-4-(4-methylphenyl)-1,3-thiazol-2-amine.
| Compound Name | N-[(Z)-[1-(4-chlorophenyl)-2-(1,2,4-triazol-1-yl)ethylidene]amino]-4-(4-methylphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 177450317 |
| Molecular Formula | C20H17ClN6S |
| Molecular Weight | 408.92 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | N-[(Z)-[1-(4-chlorophenyl)-2-(1,2,4-triazol-1-yl)ethylidene]amino]-4-(4-methylphenyl)-1,3-thiazol-2-amine |
| SMILES | Cc1ccc(-c2csc(N/N=C(\Cn3cncn3)c3ccc(Cl)cc3)n2)cc1 |
| InChI | InChI=1S/C20H17ClN6S/c1-14-2-4-16(5-3-14)19-11-28-20(24-19)26-25-18(10-27-13-22-12-23-27)15-6-8-17(21)9-7-15/h2-9,11-13H,10H2,1H3,(H,24,26)/b25-18+ |
| InChIKey | DFGRRPXOTGUJJZ-XIEYBQDHSA-N |
| XLogP | 4.88 |
| TPSA | 67.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.92 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|