C27H26ClN3OS — CID 177457387
4-(4-chlorophenyl)-N-[(E)-[2-(5-methyl-2-propan-2-ylphenoxy)-1-phenylethylidene]amino]-1,3-thiazol-2-amine (PubChem CID 177457387) has the molecular formula C27H26ClN3OS and a molecular weight of 476.05 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-[(E)-[2-(5-methyl-2-propan-2-ylphenoxy)-1-phenylethylidene]amino]-1,3-thiazol-2-amine.
| Compound Name | 4-(4-chlorophenyl)-N-[(E)-[2-(5-methyl-2-propan-2-ylphenoxy)-1-phenylethylidene]amino]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 177457387 |
| Molecular Formula | C27H26ClN3OS |
| Molecular Weight | 476.05 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | 4-(4-chlorophenyl)-N-[(E)-[2-(5-methyl-2-propan-2-ylphenoxy)-1-phenylethylidene]amino]-1,3-thiazol-2-amine |
| SMILES | Cc1ccc(C(C)C)c(OC/C(=N/Nc2nc(-c3ccc(Cl)cc3)cs2)c2ccccc2)c1 |
| InChI | InChI=1S/C27H26ClN3OS/c1-18(2)23-14-9-19(3)15-26(23)32-16-24(20-7-5-4-6-8-20)30-31-27-29-25(17-33-27)21-10-12-22(28)13-11-21/h4-15,17-18H,16H2,1-3H3,(H,29,31)/b30-24- |
| InChIKey | RYMWKGTVRXWPFI-KRUMMXJUSA-N |
| XLogP | 7.79 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.05 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|