C19H14Br2N6S — CID 66572887
4-(4-bromophenyl)-N-[(E)-[1-(4-bromophenyl)-2-(1,2,4-triazol-1-yl)ethylidene]amino]-1,3-thiazol-2-amine (PubChem CID 66572887) has the molecular formula C19H14Br2N6S and a molecular weight of 518.24 g/mol. Its IUPAC name is 4-(4-bromophenyl)-N-[(E)-[1-(4-bromophenyl)-2-(1,2,4-triazol-1-yl)ethylidene]amino]-1,3-thiazol-2-amine.
| Compound Name | 4-(4-bromophenyl)-N-[(E)-[1-(4-bromophenyl)-2-(1,2,4-triazol-1-yl)ethylidene]amino]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 66572887 |
| Molecular Formula | C19H14Br2N6S |
| Molecular Weight | 518.24 g/mol |
| Exact Mass | 515.94 |
| IUPAC Name | 4-(4-bromophenyl)-N-[(E)-[1-(4-bromophenyl)-2-(1,2,4-triazol-1-yl)ethylidene]amino]-1,3-thiazol-2-amine |
| SMILES | Brc1ccc(/C(Cn2cncn2)=N\Nc2nc(-c3ccc(Br)cc3)cs2)cc1 |
| InChI | InChI=1S/C19H14Br2N6S/c20-15-5-1-13(2-6-15)17(9-27-12-22-11-23-27)25-26-19-24-18(10-28-19)14-3-7-16(21)8-4-14/h1-8,10-12H,9H2,(H,24,26)/b25-17- |
| InChIKey | XUPXXNLFUAAUKP-UQQQWYQISA-N |
| XLogP | 5.44 |
| TPSA | 67.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.24 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|