C18H18FN4O3PS — CID 46237603
(Z)-N-[ethoxy-(4-fluorophenoxy)phosphinothioyl]oxy-1-phenyl-2-(1,2,4-triazol-1-yl)ethanimine (PubChem CID 46237603) has the molecular formula C18H18FN4O3PS and a molecular weight of 420.41 g/mol. Its IUPAC name is (Z)-N-[ethoxy-(4-fluorophenoxy)phosphinothioyl]oxy-1-phenyl-2-(1,2,4-triazol-1-yl)ethanimine.
| Compound Name | (Z)-N-[ethoxy-(4-fluorophenoxy)phosphinothioyl]oxy-1-phenyl-2-(1,2,4-triazol-1-yl)ethanimine |
|---|---|
| PubChem CID | 46237603 |
| Molecular Formula | C18H18FN4O3PS |
| Molecular Weight | 420.41 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | (Z)-N-[ethoxy-(4-fluorophenoxy)phosphinothioyl]oxy-1-phenyl-2-(1,2,4-triazol-1-yl)ethanimine |
| SMILES | CCOP(=S)(O/N=C(\Cn1cncn1)c1ccccc1)Oc1ccc(F)cc1 |
| InChI | InChI=1S/C18H18FN4O3PS/c1-2-24-27(28,25-17-10-8-16(19)9-11-17)26-22-18(12-23-14-20-13-21-23)15-6-4-3-5-7-15/h3-11,13-14H,2,12H2,1H3/b22-18+ |
| InChIKey | SSSCGOHKPIMWND-RELWKKBWSA-N |
| XLogP | 4.18 |
| TPSA | 70.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.41 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|