C9H9Cl2NO2 — CID 172562930
(NZ)-N-[1-(2,4-dichlorophenyl)-2-methoxyethylidene]hydroxylamine (PubChem CID 172562930) has the molecular formula C9H9Cl2NO2 and a molecular weight of 234.08 g/mol. Its IUPAC name is (NZ)-N-[1-(2,4-dichlorophenyl)-2-methoxyethylidene]hydroxylamine.
| Compound Name | (NZ)-N-[1-(2,4-dichlorophenyl)-2-methoxyethylidene]hydroxylamine |
|---|---|
| PubChem CID | 172562930 |
| Molecular Formula | C9H9Cl2NO2 |
| Molecular Weight | 234.08 g/mol |
| Exact Mass | 233.00 |
| IUPAC Name | (NZ)-N-[1-(2,4-dichlorophenyl)-2-methoxyethylidene]hydroxylamine |
| SMILES | COC/C(=N\O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C9H9Cl2NO2/c1-14-5-9(12-13)7-3-2-6(10)4-8(7)11/h2-4,13H,5H2,1H3/b12-9+ |
| InChIKey | KDSWMFDEGXOFRA-FMIVXFBMSA-N |
| XLogP | 2.82 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.08 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|