C22H23Cl2NO5 — CID 172562937
methyl (E)-2-[2-[[(Z)-[1-(2,4-dichlorophenyl)-2-methoxyethylidene]amino]oxymethyl]-3-methylphenyl]-3-methoxyprop-2-enoate (PubChem CID 172562937) has the molecular formula C22H23Cl2NO5 and a molecular weight of 452.33 g/mol. Its IUPAC name is methyl (E)-2-[2-[[(Z)-[1-(2,4-dichlorophenyl)-2-methoxyethylidene]amino]oxymethyl]-3-methylphenyl]-3-methoxyprop-2-enoate.
| Compound Name | methyl (E)-2-[2-[[(Z)-[1-(2,4-dichlorophenyl)-2-methoxyethylidene]amino]oxymethyl]-3-methylphenyl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 172562937 |
| Molecular Formula | C22H23Cl2NO5 |
| Molecular Weight | 452.33 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | methyl (E)-2-[2-[[(Z)-[1-(2,4-dichlorophenyl)-2-methoxyethylidene]amino]oxymethyl]-3-methylphenyl]-3-methoxyprop-2-enoate |
| SMILES | CO/C=C(/C(=O)OC)c1cccc(C)c1CO/N=C(\COC)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H23Cl2NO5/c1-14-6-5-7-16(19(11-27-2)22(26)29-4)18(14)12-30-25-21(13-28-3)17-9-8-15(23)10-20(17)24/h5-11H,12-13H2,1-4H3/b19-11+,25-21+ |
| InChIKey | ZYGMVUUSUGYIEO-TVIFTAOPSA-N |
| XLogP | 5.03 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.33 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|