C26H26FNO6 — CID 162385211
methyl 5-[(3E)-3-[[2-[(E)-1,3-dimethoxy-3-oxoprop-1-en-2-yl]-6-methylphenyl]methoxymethylimino]but-1-ynyl]-2-fluorobenzoate (PubChem CID 162385211) has the molecular formula C26H26FNO6 and a molecular weight of 467.49 g/mol. Its IUPAC name is methyl 5-[(3E)-3-[[2-[(E)-1,3-dimethoxy-3-oxoprop-1-en-2-yl]-6-methylphenyl]methoxymethylimino]but-1-ynyl]-2-fluorobenzoate.
| Compound Name | methyl 5-[(3E)-3-[[2-[(E)-1,3-dimethoxy-3-oxoprop-1-en-2-yl]-6-methylphenyl]methoxymethylimino]but-1-ynyl]-2-fluorobenzoate |
|---|---|
| PubChem CID | 162385211 |
| Molecular Formula | C26H26FNO6 |
| Molecular Weight | 467.49 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | methyl 5-[(3E)-3-[[2-[(E)-1,3-dimethoxy-3-oxoprop-1-en-2-yl]-6-methylphenyl]methoxymethylimino]but-1-ynyl]-2-fluorobenzoate |
| SMILES | CO/C=C(/C(=O)OC)c1cccc(C)c1COC/N=C(\C)C#Cc1ccc(F)c(C(=O)OC)c1 |
| InChI | InChI=1S/C26H26FNO6/c1-17-7-6-8-20(23(14-31-3)26(30)33-5)22(17)15-34-16-28-18(2)9-10-19-11-12-24(27)21(13-19)25(29)32-4/h6-8,11-14H,15-16H2,1-5H3/b23-14+,28-18+ |
| InChIKey | POOLYLRBNAFFGM-CIZIUPSFSA-N |
| XLogP | 4.07 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|