C24H23FN2O6 — CID 162385274
methyl 2-fluoro-5-[(3E)-3-[[2-[(E)-N-methoxy-C-methoxycarbonylcarbonimidoyl]-6-methylphenyl]methoxyimino]but-1-ynyl]benzoate (PubChem CID 162385274) has the molecular formula C24H23FN2O6 and a molecular weight of 454.45 g/mol. Its IUPAC name is methyl 2-fluoro-5-[(3E)-3-[[2-[(E)-N-methoxy-C-methoxycarbonylcarbonimidoyl]-6-methylphenyl]methoxyimino]but-1-ynyl]benzoate.
| Compound Name | methyl 2-fluoro-5-[(3E)-3-[[2-[(E)-N-methoxy-C-methoxycarbonylcarbonimidoyl]-6-methylphenyl]methoxyimino]but-1-ynyl]benzoate |
|---|---|
| PubChem CID | 162385274 |
| Molecular Formula | C24H23FN2O6 |
| Molecular Weight | 454.45 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | methyl 2-fluoro-5-[(3E)-3-[[2-[(E)-N-methoxy-C-methoxycarbonylcarbonimidoyl]-6-methylphenyl]methoxyimino]but-1-ynyl]benzoate |
| SMILES | CO/N=C(/C(=O)OC)c1cccc(C)c1CO/N=C(\C)C#Cc1ccc(F)c(C(=O)OC)c1 |
| InChI | InChI=1S/C24H23FN2O6/c1-15-7-6-8-18(22(27-32-5)24(29)31-4)20(15)14-33-26-16(2)9-10-17-11-12-21(25)19(13-17)23(28)30-3/h6-8,11-13H,14H2,1-5H3/b26-16+,27-22+ |
| InChIKey | KSIXDKYZMVYXSY-WUAVICBYSA-N |
| XLogP | 3.39 |
| TPSA | 95.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.45 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|