C25H27F2N2O5P — CID 170237893
propan-2-yl (2E)-2-[2-[[(E)-4-[2-[difluoro(phosphanyl)methoxy]phenyl]but-3-yn-2-ylideneamino]oxymethyl]-3-methylphenyl]-2-methoxyiminoacetate (PubChem CID 170237893) has the molecular formula C25H27F2N2O5P and a molecular weight of 504.47 g/mol. Its IUPAC name is propan-2-yl (2E)-2-[2-[[(E)-4-[2-[difluoro(phosphanyl)methoxy]phenyl]but-3-yn-2-ylideneamino]oxymethyl]-3-methylphenyl]-2-methoxyiminoacetate.
| Compound Name | propan-2-yl (2E)-2-[2-[[(E)-4-[2-[difluoro(phosphanyl)methoxy]phenyl]but-3-yn-2-ylideneamino]oxymethyl]-3-methylphenyl]-2-methoxyiminoacetate |
|---|---|
| PubChem CID | 170237893 |
| Molecular Formula | C25H27F2N2O5P |
| Molecular Weight | 504.47 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | propan-2-yl (2E)-2-[2-[[(E)-4-[2-[difluoro(phosphanyl)methoxy]phenyl]but-3-yn-2-ylideneamino]oxymethyl]-3-methylphenyl]-2-methoxyiminoacetate |
| SMILES | CO/N=C(/C(=O)OC(C)C)c1cccc(C)c1CO/N=C(\C)C#Cc1ccccc1OC(F)(F)P |
| InChI | InChI=1S/C25H27F2N2O5P/c1-16(2)33-24(30)23(29-31-5)20-11-8-9-17(3)21(20)15-32-28-18(4)13-14-19-10-6-7-12-22(19)34-25(26,27)35/h6-12,16H,15,35H2,1-5H3/b28-18+,29-23+ |
| InChIKey | QQHZYCCTMVBKSK-GWYVRFCQSA-N |
| XLogP | 5.05 |
| TPSA | 78.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.47 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|