C22H23ClFNO5 — CID 171532917
methyl (E)-2-[3-chloro-2-[[(Z)-[2-ethoxy-1-(3-fluorophenyl)ethylidene]amino]oxymethyl]phenyl]-3-methoxyprop-2-enoate (PubChem CID 171532917) has the molecular formula C22H23ClFNO5 and a molecular weight of 435.88 g/mol. Its IUPAC name is methyl (E)-2-[3-chloro-2-[[(Z)-[2-ethoxy-1-(3-fluorophenyl)ethylidene]amino]oxymethyl]phenyl]-3-methoxyprop-2-enoate.
| Compound Name | methyl (E)-2-[3-chloro-2-[[(Z)-[2-ethoxy-1-(3-fluorophenyl)ethylidene]amino]oxymethyl]phenyl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 171532917 |
| Molecular Formula | C22H23ClFNO5 |
| Molecular Weight | 435.88 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | methyl (E)-2-[3-chloro-2-[[(Z)-[2-ethoxy-1-(3-fluorophenyl)ethylidene]amino]oxymethyl]phenyl]-3-methoxyprop-2-enoate |
| SMILES | CCOC/C(=N\OCc1c(Cl)cccc1/C(=C\OC)C(=O)OC)c1cccc(F)c1 |
| InChI | InChI=1S/C22H23ClFNO5/c1-4-29-14-21(15-7-5-8-16(24)11-15)25-30-13-18-17(9-6-10-20(18)23)19(12-27-2)22(26)28-3/h5-12H,4,13-14H2,1-3H3/b19-12+,25-21+ |
| InChIKey | SZJJIHRWZGEIAB-SEPYGIQCSA-N |
| XLogP | 4.60 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.88 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|