C20H18ClF3N2O5 — CID 171532834
methyl (2E)-2-[3-chloro-2-[[(Z)-[2-methoxy-1-(3,4,5-trifluorophenyl)ethylidene]amino]oxymethyl]phenyl]-2-methoxyiminoacetate (PubChem CID 171532834) has the molecular formula C20H18ClF3N2O5 and a molecular weight of 458.82 g/mol. Its IUPAC name is methyl (2E)-2-[3-chloro-2-[[(Z)-[2-methoxy-1-(3,4,5-trifluorophenyl)ethylidene]amino]oxymethyl]phenyl]-2-methoxyiminoacetate.
| Compound Name | methyl (2E)-2-[3-chloro-2-[[(Z)-[2-methoxy-1-(3,4,5-trifluorophenyl)ethylidene]amino]oxymethyl]phenyl]-2-methoxyiminoacetate |
|---|---|
| PubChem CID | 171532834 |
| Molecular Formula | C20H18ClF3N2O5 |
| Molecular Weight | 458.82 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | methyl (2E)-2-[3-chloro-2-[[(Z)-[2-methoxy-1-(3,4,5-trifluorophenyl)ethylidene]amino]oxymethyl]phenyl]-2-methoxyiminoacetate |
| SMILES | COC/C(=N\OCc1c(Cl)cccc1/C(=N\OC)C(=O)OC)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C20H18ClF3N2O5/c1-28-10-17(11-7-15(22)18(24)16(23)8-11)25-31-9-13-12(5-4-6-14(13)21)19(26-30-3)20(27)29-2/h4-8H,9-10H2,1-3H3/b25-17+,26-19+ |
| InChIKey | KKRIMYAOSMUSMY-UKPJXLJDSA-N |
| XLogP | 3.85 |
| TPSA | 78.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.82 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|