C21H23F2N3O4 — CID 172562935
(2E)-2-[2-[[(Z)-[1-(3,4-difluorophenyl)-2-methoxyethylidene]amino]oxymethyl]-3-methylphenyl]-2-methoxyimino-N-methylacetamide (PubChem CID 172562935) has the molecular formula C21H23F2N3O4 and a molecular weight of 419.43 g/mol. Its IUPAC name is (2E)-2-[2-[[(Z)-[1-(3,4-difluorophenyl)-2-methoxyethylidene]amino]oxymethyl]-3-methylphenyl]-2-methoxyimino-N-methylacetamide.
| Compound Name | (2E)-2-[2-[[(Z)-[1-(3,4-difluorophenyl)-2-methoxyethylidene]amino]oxymethyl]-3-methylphenyl]-2-methoxyimino-N-methylacetamide |
|---|---|
| PubChem CID | 172562935 |
| Molecular Formula | C21H23F2N3O4 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | (2E)-2-[2-[[(Z)-[1-(3,4-difluorophenyl)-2-methoxyethylidene]amino]oxymethyl]-3-methylphenyl]-2-methoxyimino-N-methylacetamide |
| SMILES | CNC(=O)/C(=N/OC)c1cccc(C)c1CO/N=C(\COC)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C21H23F2N3O4/c1-13-6-5-7-15(20(26-29-4)21(27)24-2)16(13)11-30-25-19(12-28-3)14-8-9-17(22)18(23)10-14/h5-10H,11-12H2,1-4H3,(H,24,27)/b25-19+,26-20+ |
| InChIKey | JLALMEOSQAEQKA-FQHZWJPGSA-N |
| XLogP | 2.94 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|