C21H23ClFN3O4 — CID 171532907
(2E)-2-[3-chloro-2-[[(Z)-[2-ethoxy-1-(4-fluorophenyl)ethylidene]amino]oxymethyl]phenyl]-2-methoxyimino-N-methylacetamide (PubChem CID 171532907) has the molecular formula C21H23ClFN3O4 and a molecular weight of 435.88 g/mol. Its IUPAC name is (2E)-2-[3-chloro-2-[[(Z)-[2-ethoxy-1-(4-fluorophenyl)ethylidene]amino]oxymethyl]phenyl]-2-methoxyimino-N-methylacetamide.
| Compound Name | (2E)-2-[3-chloro-2-[[(Z)-[2-ethoxy-1-(4-fluorophenyl)ethylidene]amino]oxymethyl]phenyl]-2-methoxyimino-N-methylacetamide |
|---|---|
| PubChem CID | 171532907 |
| Molecular Formula | C21H23ClFN3O4 |
| Molecular Weight | 435.88 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | (2E)-2-[3-chloro-2-[[(Z)-[2-ethoxy-1-(4-fluorophenyl)ethylidene]amino]oxymethyl]phenyl]-2-methoxyimino-N-methylacetamide |
| SMILES | CCOC/C(=N\OCc1c(Cl)cccc1/C(=N\OC)C(=O)NC)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H23ClFN3O4/c1-4-29-13-19(14-8-10-15(23)11-9-14)25-30-12-17-16(6-5-7-18(17)22)20(26-28-3)21(27)24-2/h5-11H,4,12-13H2,1-3H3,(H,24,27)/b25-19+,26-20+ |
| InChIKey | HWFJOYFFQAHGTC-FQHZWJPGSA-N |
| XLogP | 3.53 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.88 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|