C23H27ClF3N3O4 — CID 157023816
(2E)-2-[2-[[(E)-1-[4-chloro-2-(trifluoromethoxy)phenyl]ethylideneamino]oxymethyl]-3-methylphenyl]-2-methoxyimino-N-methylacetamide;ethane (PubChem CID 157023816) has the molecular formula C23H27ClF3N3O4 and a molecular weight of 501.93 g/mol. Its IUPAC name is (2E)-2-[2-[[(E)-1-[4-chloro-2-(trifluoromethoxy)phenyl]ethylideneamino]oxymethyl]-3-methylphenyl]-2-methoxyimino-N-methylacetamide;ethane.
| Compound Name | (2E)-2-[2-[[(E)-1-[4-chloro-2-(trifluoromethoxy)phenyl]ethylideneamino]oxymethyl]-3-methylphenyl]-2-methoxyimino-N-methylacetamide;ethane |
|---|---|
| PubChem CID | 157023816 |
| Molecular Formula | C23H27ClF3N3O4 |
| Molecular Weight | 501.93 g/mol |
| Exact Mass | 501.16 |
| IUPAC Name | (2E)-2-[2-[[(E)-1-[4-chloro-2-(trifluoromethoxy)phenyl]ethylideneamino]oxymethyl]-3-methylphenyl]-2-methoxyimino-N-methylacetamide;ethane |
| SMILES | CC.CNC(=O)/C(=N/OC)c1cccc(C)c1CO/N=C(\C)c1ccc(Cl)cc1OC(F)(F)F |
| InChI | InChI=1S/C21H21ClF3N3O4.C2H6/c1-12-6-5-7-16(19(28-30-4)20(29)26-3)17(12)11-31-27-13(2)15-9-8-14(22)10-18(15)32-21(23,24)25;1-2/h5-10H,11H2,1-4H3,(H,26,29);1-2H3/b27-13+,28-19+; |
| InChIKey | WUTVVTLOUHMTPF-VGOYGLBXSA-N |
| XLogP | 5.61 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.93 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|