C20H20F4N2O3 — CID 157024503
(E)-1-[2-fluoro-4-(trifluoromethoxy)phenyl]-N-[[2-[(Z)-N-methoxy-C-methylcarbonimidoyl]-6-methylphenyl]methoxy]ethanimine (PubChem CID 157024503) has the molecular formula C20H20F4N2O3 and a molecular weight of 412.38 g/mol. Its IUPAC name is (E)-1-[2-fluoro-4-(trifluoromethoxy)phenyl]-N-[[2-[(Z)-N-methoxy-C-methylcarbonimidoyl]-6-methylphenyl]methoxy]ethanimine.
| Compound Name | (E)-1-[2-fluoro-4-(trifluoromethoxy)phenyl]-N-[[2-[(Z)-N-methoxy-C-methylcarbonimidoyl]-6-methylphenyl]methoxy]ethanimine |
|---|---|
| PubChem CID | 157024503 |
| Molecular Formula | C20H20F4N2O3 |
| Molecular Weight | 412.38 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | (E)-1-[2-fluoro-4-(trifluoromethoxy)phenyl]-N-[[2-[(Z)-N-methoxy-C-methylcarbonimidoyl]-6-methylphenyl]methoxy]ethanimine |
| SMILES | CO/N=C(/C)c1cccc(C)c1CO/N=C(\C)c1ccc(OC(F)(F)F)cc1F |
| InChI | InChI=1S/C20H20F4N2O3/c1-12-6-5-7-16(13(2)25-27-4)18(12)11-28-26-14(3)17-9-8-15(10-19(17)21)29-20(22,23)24/h5-10H,11H2,1-4H3/b25-13-,26-14+ |
| InChIKey | DLRJOYFCGZYMFZ-KGRJIBJCSA-N |
| XLogP | 5.34 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.38 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|