C20H21ClF3N3O3 — CID 157023822
2-[[(E)-1-[2-chloro-4-(trifluoromethoxy)phenyl]ethylideneamino]oxymethyl]-N-methoxy-N',3-dimethylbenzenecarboximidamide (PubChem CID 157023822) has the molecular formula C20H21ClF3N3O3 and a molecular weight of 443.85 g/mol. Its IUPAC name is 2-[[(E)-1-[2-chloro-4-(trifluoromethoxy)phenyl]ethylideneamino]oxymethyl]-N-methoxy-N',3-dimethylbenzenecarboximidamide.
| Compound Name | 2-[[(E)-1-[2-chloro-4-(trifluoromethoxy)phenyl]ethylideneamino]oxymethyl]-N-methoxy-N',3-dimethylbenzenecarboximidamide |
|---|---|
| PubChem CID | 157023822 |
| Molecular Formula | C20H21ClF3N3O3 |
| Molecular Weight | 443.85 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | 2-[[(E)-1-[2-chloro-4-(trifluoromethoxy)phenyl]ethylideneamino]oxymethyl]-N-methoxy-N',3-dimethylbenzenecarboximidamide |
| SMILES | C/N=C(\NOC)c1cccc(C)c1CO/N=C(\C)c1ccc(OC(F)(F)F)cc1Cl |
| InChI | InChI=1S/C20H21ClF3N3O3/c1-12-6-5-7-16(19(25-3)27-28-4)17(12)11-29-26-13(2)15-9-8-14(10-18(15)21)30-20(22,23)24/h5-10H,11H2,1-4H3,(H,25,27)/b26-13+ |
| InChIKey | LPRRQKHBPIANKE-LGJNPRDNSA-N |
| XLogP | 5.02 |
| TPSA | 64.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.85 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|