C21H24ClF4N3O3 — CID 157024500
chloromethane;N-fluoro-N'-methoxy-N,3-dimethyl-2-[[(E)-1-[4-(trifluoromethoxy)phenyl]ethylideneamino]oxymethyl]benzenecarboximidamide (PubChem CID 157024500) has the molecular formula C21H24ClF4N3O3 and a molecular weight of 477.89 g/mol. Its IUPAC name is chloromethane;N-fluoro-N'-methoxy-N,3-dimethyl-2-[[(E)-1-[4-(trifluoromethoxy)phenyl]ethylideneamino]oxymethyl]benzenecarboximidamide.
| Compound Name | chloromethane;N-fluoro-N'-methoxy-N,3-dimethyl-2-[[(E)-1-[4-(trifluoromethoxy)phenyl]ethylideneamino]oxymethyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 157024500 |
| Molecular Formula | C21H24ClF4N3O3 |
| Molecular Weight | 477.89 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | chloromethane;N-fluoro-N'-methoxy-N,3-dimethyl-2-[[(E)-1-[4-(trifluoromethoxy)phenyl]ethylideneamino]oxymethyl]benzenecarboximidamide |
| SMILES | CCl.CO/N=C(\c1cccc(C)c1CO/N=C(\C)c1ccc(OC(F)(F)F)cc1)N(C)F |
| InChI | InChI=1S/C20H21F4N3O3.CH3Cl/c1-13-6-5-7-17(19(26-28-4)27(3)24)18(13)12-29-25-14(2)15-8-10-16(11-9-15)30-20(21,22)23;1-2/h5-11H,12H2,1-4H3;1H3/b25-14+,26-19+; |
| InChIKey | DAHFPJOBUQRZFU-GBMRJNTNSA-N |
| XLogP | 5.81 |
| TPSA | 55.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.89 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|