C17H22F3N5O2 — CID 162729188
N-methoxy-N',3-dimethyl-2-[[(E)-[2-methyl-3-(trifluoromethyl)-1,3-dihydropyrazol-5-yl]methylideneamino]oxymethyl]benzenecarboximidamide (PubChem CID 162729188) has the molecular formula C17H22F3N5O2 and a molecular weight of 385.39 g/mol. Its IUPAC name is N-methoxy-N',3-dimethyl-2-[[(E)-[2-methyl-3-(trifluoromethyl)-1,3-dihydropyrazol-5-yl]methylideneamino]oxymethyl]benzenecarboximidamide.
| Compound Name | N-methoxy-N',3-dimethyl-2-[[(E)-[2-methyl-3-(trifluoromethyl)-1,3-dihydropyrazol-5-yl]methylideneamino]oxymethyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 162729188 |
| Molecular Formula | C17H22F3N5O2 |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | N-methoxy-N',3-dimethyl-2-[[(E)-[2-methyl-3-(trifluoromethyl)-1,3-dihydropyrazol-5-yl]methylideneamino]oxymethyl]benzenecarboximidamide |
| SMILES | C/N=C(\NOC)c1cccc(C)c1CO/N=C/C1=CC(C(F)(F)F)N(C)N1 |
| InChI | InChI=1S/C17H22F3N5O2/c1-11-6-5-7-13(16(21-2)24-26-4)14(11)10-27-22-9-12-8-15(17(18,19)20)25(3)23-12/h5-9,15,23H,10H2,1-4H3,(H,21,24)/b22-9+ |
| InChIKey | POWFPBFEICOPLP-LSFURLLWSA-N |
| XLogP | 2.29 |
| TPSA | 70.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|