C20H21BrN2O5 — CID 171532870
methyl (2E)-2-[3-bromo-2-[[(Z)-(2-methoxy-1-phenylethylidene)amino]oxymethyl]phenyl]-2-methoxyiminoacetate (PubChem CID 171532870) has the molecular formula C20H21BrN2O5 and a molecular weight of 449.30 g/mol. Its IUPAC name is methyl (2E)-2-[3-bromo-2-[[(Z)-(2-methoxy-1-phenylethylidene)amino]oxymethyl]phenyl]-2-methoxyiminoacetate.
| Compound Name | methyl (2E)-2-[3-bromo-2-[[(Z)-(2-methoxy-1-phenylethylidene)amino]oxymethyl]phenyl]-2-methoxyiminoacetate |
|---|---|
| PubChem CID | 171532870 |
| Molecular Formula | C20H21BrN2O5 |
| Molecular Weight | 449.30 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | methyl (2E)-2-[3-bromo-2-[[(Z)-(2-methoxy-1-phenylethylidene)amino]oxymethyl]phenyl]-2-methoxyiminoacetate |
| SMILES | COC/C(=N\OCc1c(Br)cccc1/C(=N\OC)C(=O)OC)c1ccccc1 |
| InChI | InChI=1S/C20H21BrN2O5/c1-25-13-18(14-8-5-4-6-9-14)22-28-12-16-15(10-7-11-17(16)21)19(23-27-3)20(24)26-2/h4-11H,12-13H2,1-3H3/b22-18+,23-19+ |
| InChIKey | JILXBGUYKKLNIU-DPIBHUQISA-N |
| XLogP | 3.54 |
| TPSA | 78.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.30 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|