C12H13BrClNO3 — CID 174340395
methyl 2-[2-(2-bromoethyl)-3-chlorophenyl]-2-methoxyiminoacetate (PubChem CID 174340395) has the molecular formula C12H13BrClNO3 and a molecular weight of 334.60 g/mol. Its IUPAC name is methyl 2-[2-(2-bromoethyl)-3-chlorophenyl]-2-methoxyiminoacetate.
| Compound Name | methyl 2-[2-(2-bromoethyl)-3-chlorophenyl]-2-methoxyiminoacetate |
|---|---|
| PubChem CID | 174340395 |
| Molecular Formula | C12H13BrClNO3 |
| Molecular Weight | 334.60 g/mol |
| Exact Mass | 332.98 |
| IUPAC Name | methyl 2-[2-(2-bromoethyl)-3-chlorophenyl]-2-methoxyiminoacetate |
| SMILES | CON=C(C(=O)OC)c1cccc(Cl)c1CCBr |
| InChI | InChI=1S/C12H13BrClNO3/c1-17-12(16)11(15-18-2)9-4-3-5-10(14)8(9)6-7-13/h3-5H,6-7H2,1-2H3 |
| InChIKey | QRVQGCRHDOCDGH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.60 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|