C21H20Cl3NO5 — CID 171532887
methyl (E)-2-[3-chloro-2-[[(Z)-[1-(3,4-dichlorophenyl)-2-methoxyethylidene]amino]oxymethyl]phenyl]-3-methoxyprop-2-enoate (PubChem CID 171532887) has the molecular formula C21H20Cl3NO5 and a molecular weight of 472.75 g/mol. Its IUPAC name is methyl (E)-2-[3-chloro-2-[[(Z)-[1-(3,4-dichlorophenyl)-2-methoxyethylidene]amino]oxymethyl]phenyl]-3-methoxyprop-2-enoate.
| Compound Name | methyl (E)-2-[3-chloro-2-[[(Z)-[1-(3,4-dichlorophenyl)-2-methoxyethylidene]amino]oxymethyl]phenyl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 171532887 |
| Molecular Formula | C21H20Cl3NO5 |
| Molecular Weight | 472.75 g/mol |
| Exact Mass | 471.04 |
| IUPAC Name | methyl (E)-2-[3-chloro-2-[[(Z)-[1-(3,4-dichlorophenyl)-2-methoxyethylidene]amino]oxymethyl]phenyl]-3-methoxyprop-2-enoate |
| SMILES | CO/C=C(/C(=O)OC)c1cccc(Cl)c1CO/N=C(\COC)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H20Cl3NO5/c1-27-10-16(21(26)29-3)14-5-4-6-17(22)15(14)11-30-25-20(12-28-2)13-7-8-18(23)19(24)9-13/h4-10H,11-12H2,1-3H3/b16-10+,25-20+ |
| InChIKey | TYADDVUVXFGKJX-JILMVDGVSA-N |
| XLogP | 5.37 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.75 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|