C8H5Cl2F2NO — CID 22769416
(NZ)-N-[1-(2,4-dichlorophenyl)-2,2-difluoroethylidene]hydroxylamine (PubChem CID 22769416) has the molecular formula C8H5Cl2F2NO and a molecular weight of 240.04 g/mol. Its IUPAC name is (NZ)-N-[1-(2,4-dichlorophenyl)-2,2-difluoroethylidene]hydroxylamine.
| Compound Name | (NZ)-N-[1-(2,4-dichlorophenyl)-2,2-difluoroethylidene]hydroxylamine |
|---|---|
| PubChem CID | 22769416 |
| Molecular Formula | C8H5Cl2F2NO |
| Molecular Weight | 240.04 g/mol |
| Exact Mass | 238.97 |
| IUPAC Name | (NZ)-N-[1-(2,4-dichlorophenyl)-2,2-difluoroethylidene]hydroxylamine |
| SMILES | O/N=C(/c1ccc(Cl)cc1Cl)C(F)F |
| InChI | InChI=1S/C8H5Cl2F2NO/c9-4-1-2-5(6(10)3-4)7(13-14)8(11)12/h1-3,8,14H/b13-7- |
| InChIKey | QFGDAZSJRRNLKE-QPEQYQDCSA-N |
| XLogP | 3.44 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.04 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|