C18H13Cl4N3O2 — CID 172687863
N-[1,3-bis(2,4-dichlorophenyl)-2-imidazol-1-yloxypropylidene]hydroxylamine (PubChem CID 172687863) has the molecular formula C18H13Cl4N3O2 and a molecular weight of 445.13 g/mol. Its IUPAC name is N-[1,3-bis(2,4-dichlorophenyl)-2-imidazol-1-yloxypropylidene]hydroxylamine.
| Compound Name | N-[1,3-bis(2,4-dichlorophenyl)-2-imidazol-1-yloxypropylidene]hydroxylamine |
|---|---|
| PubChem CID | 172687863 |
| Molecular Formula | C18H13Cl4N3O2 |
| Molecular Weight | 445.13 g/mol |
| Exact Mass | 442.98 |
| IUPAC Name | N-[1,3-bis(2,4-dichlorophenyl)-2-imidazol-1-yloxypropylidene]hydroxylamine |
| SMILES | ON=C(c1ccc(Cl)cc1Cl)C(Cc1ccc(Cl)cc1Cl)On1ccnc1 |
| InChI | InChI=1S/C18H13Cl4N3O2/c19-12-2-1-11(15(21)8-12)7-17(27-25-6-5-23-10-25)18(24-26)14-4-3-13(20)9-16(14)22/h1-6,8-10,17,26H,7H2 |
| InChIKey | BGUQNHNFGXRVKM-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.13 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|