C13H8BrCl2NO — CID 73431883
N-[(4-bromophenyl)-(2,4-dichlorophenyl)methylidene]hydroxylamine (PubChem CID 73431883) has the molecular formula C13H8BrCl2NO and a molecular weight of 345.02 g/mol. Its IUPAC name is N-[(4-bromophenyl)-(2,4-dichlorophenyl)methylidene]hydroxylamine.
| Compound Name | N-[(4-bromophenyl)-(2,4-dichlorophenyl)methylidene]hydroxylamine |
|---|---|
| PubChem CID | 73431883 |
| Molecular Formula | C13H8BrCl2NO |
| Molecular Weight | 345.02 g/mol |
| Exact Mass | 342.92 |
| IUPAC Name | N-[(4-bromophenyl)-(2,4-dichlorophenyl)methylidene]hydroxylamine |
| SMILES | ON=C(c1ccc(Br)cc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H8BrCl2NO/c14-9-3-1-8(2-4-9)13(17-18)11-6-5-10(15)7-12(11)16/h1-7,18H |
| InChIKey | MEJNFPNGQLKNCF-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.02 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|