C14H10BrCl2N — CID 162250904
2-(4-bromophenyl)-1-(2,4-dichlorophenyl)ethanimine (PubChem CID 162250904) has the molecular formula C14H10BrCl2N and a molecular weight of 343.05 g/mol. Its IUPAC name is 2-(4-bromophenyl)-1-(2,4-dichlorophenyl)ethanimine.
| Compound Name | 2-(4-bromophenyl)-1-(2,4-dichlorophenyl)ethanimine |
|---|---|
| PubChem CID | 162250904 |
| Molecular Formula | C14H10BrCl2N |
| Molecular Weight | 343.05 g/mol |
| Exact Mass | 340.94 |
| IUPAC Name | 2-(4-bromophenyl)-1-(2,4-dichlorophenyl)ethanimine |
| SMILES | [H]/N=C(/Cc1ccc(Br)cc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H10BrCl2N/c15-10-3-1-9(2-4-10)7-14(18)12-6-5-11(16)8-13(12)17/h1-6,8,18H,7H2/b18-14- |
| InChIKey | OLSLNDLVXAOLDZ-JXAWBTAJSA-N |
| XLogP | 5.37 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.05 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|