C9H15Cl2N2O3P — CID 2795150
(2-amino-4-chloroanilino)methyl-ethoxyphosphinic acid;hydrochloride (PubChem CID 2795150) has the molecular formula C9H15Cl2N2O3P and a molecular weight of 301.11 g/mol. Its IUPAC name is (2-amino-4-chloroanilino)methyl-ethoxyphosphinic acid;hydrochloride.
| Compound Name | (2-amino-4-chloroanilino)methyl-ethoxyphosphinic acid;hydrochloride |
|---|---|
| PubChem CID | 2795150 |
| Molecular Formula | C9H15Cl2N2O3P |
| Molecular Weight | 301.11 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | (2-amino-4-chloroanilino)methyl-ethoxyphosphinic acid;hydrochloride |
| SMILES | CCOP(=O)(O)CNc1ccc(Cl)cc1N.Cl |
| InChI | InChI=1S/C9H14ClN2O3P.ClH/c1-2-15-16(13,14)6-12-9-4-3-7(10)5-8(9)11;/h3-5,12H,2,6,11H2,1H3,(H,13,14);1H |
| InChIKey | RPSKGUKEKBOSLI-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.11 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|