C14H22NO4PS — CID 88711008
1-[4-[ethoxy(propylsulfanyl)phosphoryl]oxyphenyl]-N-methoxyethanimine (PubChem CID 88711008) has the molecular formula C14H22NO4PS and a molecular weight of 331.37 g/mol. Its IUPAC name is 1-[4-[ethoxy(propylsulfanyl)phosphoryl]oxyphenyl]-N-methoxyethanimine.
| Compound Name | 1-[4-[ethoxy(propylsulfanyl)phosphoryl]oxyphenyl]-N-methoxyethanimine |
|---|---|
| PubChem CID | 88711008 |
| Molecular Formula | C14H22NO4PS |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 1-[4-[ethoxy(propylsulfanyl)phosphoryl]oxyphenyl]-N-methoxyethanimine |
| SMILES | CCCSP(=O)(OCC)Oc1ccc(C(C)=NOC)cc1 |
| InChI | InChI=1S/C14H22NO4PS/c1-5-11-21-20(16,18-6-2)19-14-9-7-13(8-10-14)12(3)15-17-4/h7-10H,5-6,11H2,1-4H3 |
| InChIKey | OBXCFIKIFHKHMB-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|