C14H21N2O5PS — CID 57018896
methyl N-[[2-[ethoxy(propylsulfanyl)phosphoryl]oxyphenyl]methylideneamino]carbamate (PubChem CID 57018896) has the molecular formula C14H21N2O5PS and a molecular weight of 360.37 g/mol. Its IUPAC name is methyl N-[[2-[ethoxy(propylsulfanyl)phosphoryl]oxyphenyl]methylideneamino]carbamate.
| Compound Name | methyl N-[[2-[ethoxy(propylsulfanyl)phosphoryl]oxyphenyl]methylideneamino]carbamate |
|---|---|
| PubChem CID | 57018896 |
| Molecular Formula | C14H21N2O5PS |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | methyl N-[[2-[ethoxy(propylsulfanyl)phosphoryl]oxyphenyl]methylideneamino]carbamate |
| SMILES | CCCSP(=O)(OCC)Oc1ccccc1C=NNC(=O)OC |
| InChI | InChI=1S/C14H21N2O5PS/c1-4-10-23-22(18,20-5-2)21-13-9-7-6-8-12(13)11-15-16-14(17)19-3/h6-9,11H,4-5,10H2,1-3H3,(H,16,17) |
| InChIKey | RJGRHZJJICHXRK-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|