C15H22ClO3PS — CID 21442689
1-(2-chloroprop-2-enyl)-2-[ethoxy(2-methylpropylsulfanyl)phosphoryl]oxybenzene (PubChem CID 21442689) has the molecular formula C15H22ClO3PS and a molecular weight of 348.83 g/mol. Its IUPAC name is 1-(2-chloroprop-2-enyl)-2-[ethoxy(2-methylpropylsulfanyl)phosphoryl]oxybenzene.
| Compound Name | 1-(2-chloroprop-2-enyl)-2-[ethoxy(2-methylpropylsulfanyl)phosphoryl]oxybenzene |
|---|---|
| PubChem CID | 21442689 |
| Molecular Formula | C15H22ClO3PS |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 1-(2-chloroprop-2-enyl)-2-[ethoxy(2-methylpropylsulfanyl)phosphoryl]oxybenzene |
| SMILES | C=C(Cl)Cc1ccccc1OP(=O)(OCC)SCC(C)C |
| InChI | InChI=1S/C15H22ClO3PS/c1-5-18-20(17,21-11-12(2)3)19-15-9-7-6-8-14(15)10-13(4)16/h6-9,12H,4-5,10-11H2,1-3H3 |
| InChIKey | NTUHMKLXFFAJJE-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|