C12H20N3O2PS2 — CID 54109028
1-[ethoxy(2-methylpropylsulfanyl)phosphoryl]-3-pyridin-2-ylthiourea (PubChem CID 54109028) has the molecular formula C12H20N3O2PS2 and a molecular weight of 333.42 g/mol. Its IUPAC name is 1-[ethoxy(2-methylpropylsulfanyl)phosphoryl]-3-pyridin-2-ylthiourea.
| Compound Name | 1-[ethoxy(2-methylpropylsulfanyl)phosphoryl]-3-pyridin-2-ylthiourea |
|---|---|
| PubChem CID | 54109028 |
| Molecular Formula | C12H20N3O2PS2 |
| Molecular Weight | 333.42 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 1-[ethoxy(2-methylpropylsulfanyl)phosphoryl]-3-pyridin-2-ylthiourea |
| SMILES | CCOP(=O)(NC(=S)Nc1ccccn1)SCC(C)C |
| InChI | InChI=1S/C12H20N3O2PS2/c1-4-17-18(16,20-9-10(2)3)15-12(19)14-11-7-5-6-8-13-11/h5-8,10H,4,9H2,1-3H3,(H2,13,14,15,16,19) |
| InChIKey | NFTSNZNRMPAKMV-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|