C14H13N3O2S — CID 726295
methyl 4-(pyridin-2-ylcarbamothioylamino)benzoate (PubChem CID 726295) has the molecular formula C14H13N3O2S and a molecular weight of 287.34 g/mol. Its IUPAC name is methyl 4-(pyridin-2-ylcarbamothioylamino)benzoate.
| Compound Name | methyl 4-(pyridin-2-ylcarbamothioylamino)benzoate |
|---|---|
| PubChem CID | 726295 |
| Molecular Formula | C14H13N3O2S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | methyl 4-(pyridin-2-ylcarbamothioylamino)benzoate |
| SMILES | COC(=O)c1ccc(NC(=S)Nc2ccccn2)cc1 |
| InChI | InChI=1S/C14H13N3O2S/c1-19-13(18)10-5-7-11(8-6-10)16-14(20)17-12-4-2-3-9-15-12/h2-9H,1H3,(H2,15,16,17,20) |
| InChIKey | DWZLBWQNMNGXIJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|