C21H27O4PS — CID 54287518
[3,5-dimethyl-4-[propan-2-yloxy(propylsulfanyl)phosphoryl]oxyphenyl]-phenylmethanone (PubChem CID 54287518) has the molecular formula C21H27O4PS and a molecular weight of 406.48 g/mol. Its IUPAC name is [3,5-dimethyl-4-[propan-2-yloxy(propylsulfanyl)phosphoryl]oxyphenyl]-phenylmethanone.
| Compound Name | [3,5-dimethyl-4-[propan-2-yloxy(propylsulfanyl)phosphoryl]oxyphenyl]-phenylmethanone |
|---|---|
| PubChem CID | 54287518 |
| Molecular Formula | C21H27O4PS |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | [3,5-dimethyl-4-[propan-2-yloxy(propylsulfanyl)phosphoryl]oxyphenyl]-phenylmethanone |
| SMILES | CCCSP(=O)(Oc1c(C)cc(C(=O)c2ccccc2)cc1C)OC(C)C |
| InChI | InChI=1S/C21H27O4PS/c1-6-12-27-26(23,24-15(2)3)25-21-16(4)13-19(14-17(21)5)20(22)18-10-8-7-9-11-18/h7-11,13-15H,6,12H2,1-5H3 |
| InChIKey | RVEMWTLEOCVLMN-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|