C25H30F3N3O — CID 146147993
3-[4-(benzylamino)piperidin-1-yl]-1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-2-one (PubChem CID 146147993) has the molecular formula C25H30F3N3O and a molecular weight of 445.53 g/mol. Its IUPAC name is 3-[4-(benzylamino)piperidin-1-yl]-1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-2-one.
| Compound Name | 3-[4-(benzylamino)piperidin-1-yl]-1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-2-one |
|---|---|
| PubChem CID | 146147993 |
| Molecular Formula | C25H30F3N3O |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | 3-[4-(benzylamino)piperidin-1-yl]-1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-2-one |
| SMILES | O=C1C(N2CCC(NCc3ccccc3)CC2)CCCN1Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H30F3N3O/c26-25(27,28)21-9-4-8-20(16-21)18-31-13-5-10-23(24(31)32)30-14-11-22(12-15-30)29-17-19-6-2-1-3-7-19/h1-4,6-9,16,22-23,29H,5,10-15,17-18H2 |
| InChIKey | IVDUJAICDZPVFX-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |