C22H25F5N2O2 — CID 68945958
1-[2-(2,4-difluorophenoxy)ethyl]-4-[3-[3-(trifluoromethyl)phenoxy]propyl]piperazine (PubChem CID 68945958) has the molecular formula C22H25F5N2O2 and a molecular weight of 444.44 g/mol. Its IUPAC name is 1-[2-(2,4-difluorophenoxy)ethyl]-4-[3-[3-(trifluoromethyl)phenoxy]propyl]piperazine.
| Compound Name | 1-[2-(2,4-difluorophenoxy)ethyl]-4-[3-[3-(trifluoromethyl)phenoxy]propyl]piperazine |
|---|---|
| PubChem CID | 68945958 |
| Molecular Formula | C22H25F5N2O2 |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 1-[2-(2,4-difluorophenoxy)ethyl]-4-[3-[3-(trifluoromethyl)phenoxy]propyl]piperazine |
| SMILES | Fc1ccc(OCCN2CCN(CCCOc3cccc(C(F)(F)F)c3)CC2)c(F)c1 |
| InChI | InChI=1S/C22H25F5N2O2/c23-18-5-6-21(20(24)16-18)31-14-12-29-10-8-28(9-11-29)7-2-13-30-19-4-1-3-17(15-19)22(25,26)27/h1,3-6,15-16H,2,7-14H2 |
| InChIKey | SVDSMOMNHOHUPS-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|